About (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one
(2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one (PubChem CID 67561856) has the molecular formula C12H23FN4O
and a molecular weight of 258.34 g/mol. Its IUPAC name is (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one.
Molecular Properties
| Compound Name | (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one |
| PubChem CID | 67561856 |
| Molecular Formula | C12H23FN4O |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one |
| SMILES | N[C@@H]1C[C@H](F)CN1C(=O)[C@@H](N)CC1CCCNC1 |
| InChI | InChI=1S/C12H23FN4O/c13-9-5-11(15)17(7-9)12(18)10(14)4-8-2-1-3-16-6-8/h8-11,16H,1-7,14-15H2/t8?,9-,10-,11-/m0/s1 |
| InChIKey | DAGQJYNKGJKOQI-KQFSYOIOSA-N |
| XLogP | -0.44 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one?
The IUPAC name of (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one (CID 67561856) is (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one.
What is the SMILES notation for (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one?
The canonical SMILES for (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one is N[C@@H]1C[C@H](F)CN1C(=O)[C@@H](N)CC1CCCNC1.
What is the InChIKey of (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one?
The InChIKey is DAGQJYNKGJKOQI-KQFSYOIOSA-N. The full InChI is InChI=1S/C12H23FN4O/c13-9-5-11(15)17(7-9)12(18)10(14)4-8-2-1-3-16-6-8/h8-11,16H,1-7,14-15H2/t8?,9-,10-,11-/m0/s1.
What are the key properties of (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one?
(2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one has a molecular weight of 258.34 g/mol, XLogP of -0.44, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-1-[(2S,4S)-2-amino-4-fluoropyrrolidin-1-yl]-3-piperidin-3-ylpropan-1-one is sourced from PubChem (CID 67561856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).