C14H19BrO9 — CID 67562059
1-hydroxy-1-[(2R,3R,4S,5S)-3,4,5-triacetyl-6-bromo-3,4,5-trihydroxyoxan-2-yl]propan-2-one (PubChem CID 67562059) has the molecular formula C14H19BrO9 and a molecular weight of 411.20 g/mol. Its IUPAC name is 1-hydroxy-1-[(2R,3R,4S,5S)-3,4,5-triacetyl-6-bromo-3,4,5-trihydroxyoxan-2-yl]propan-2-one.
| Compound Name | 1-hydroxy-1-[(2R,3R,4S,5S)-3,4,5-triacetyl-6-bromo-3,4,5-trihydroxyoxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 67562059 |
| Molecular Formula | C14H19BrO9 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 1-hydroxy-1-[(2R,3R,4S,5S)-3,4,5-triacetyl-6-bromo-3,4,5-trihydroxyoxan-2-yl]propan-2-one |
| SMILES | CC(=O)C(O)[C@H]1OC(Br)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C14H19BrO9/c1-5(16)9(20)10-12(21,6(2)17)14(23,8(4)19)13(22,7(3)18)11(15)24-10/h9-11,20-23H,1-4H3/t9?,10-,11?,12-,13+,14+/m1/s1 |
| InChIKey | VPQUKCWUGUDXRY-GCYFGFEUSA-N |
| XLogP | -1.98 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|