C27H43BN2O7 — CID 67562072
N-[(2S)-3-hydroxy-1-[[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxopropan-2-yl]-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 67562072) has the molecular formula C27H43BN2O7 and a molecular weight of 518.46 g/mol. Its IUPAC name is N-[(2S)-3-hydroxy-1-[[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxopropan-2-yl]-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[(2S)-3-hydroxy-1-[[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxopropan-2-yl]-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 67562072 |
| Molecular Formula | C27H43BN2O7 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | N-[(2S)-3-hydroxy-1-[[3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxopropan-2-yl]-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | COc1ccc2c(c1OC)CCC(C(=O)N[C@@H](CO)C(=O)NC(CC(C)C)B1OC(C)(C)C(C)(C)O1)C2 |
| InChI | InChI=1S/C27H43BN2O7/c1-16(2)13-22(28-36-26(3,4)27(5,6)37-28)30-25(33)20(15-31)29-24(32)18-9-11-19-17(14-18)10-12-21(34-7)23(19)35-8/h10,12,16,18,20,22,31H,9,11,13-15H2,1-8H3,(H,29,32)(H,30,33)/t18?,20-,22?/m0/s1 |
| InChIKey | CFJHXRAXELHSMZ-JGBTYHIZSA-N |
| XLogP | 2.45 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|