About 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide
2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide (PubChem CID 67562649) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide |
| PubChem CID | 67562649 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide |
| SMILES | CC1=CCC=C(N(C)C(=O)CNC2CCCCC2)C=C1 |
| InChI | InChI=1S/C17H26N2O/c1-14-7-6-10-16(12-11-14)19(2)17(20)13-18-15-8-4-3-5-9-15/h7,10-12,15,18H,3-6,8-9,13H2,1-2H3 |
| InChIKey | CXBMCTHDTXQHHI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The IUPAC name of 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide (CID 67562649) is 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide.
What is the SMILES notation for 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The canonical SMILES for 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide is CC1=CCC=C(N(C)C(=O)CNC2CCCCC2)C=C1.
What is the InChIKey of 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The InChIKey is CXBMCTHDTXQHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c1-14-7-6-10-16(12-11-14)19(2)17(20)13-18-15-8-4-3-5-9-15/h7,10-12,15,18H,3-6,8-9,13H2,1-2H3.
What are the key properties of 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide has a molecular weight of 274.41 g/mol, XLogP of 3.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide is sourced from PubChem (CID 67562649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).