About (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide
(5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide (PubChem CID 67562652) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide.
Molecular Properties
| Compound Name | (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide |
| PubChem CID | 67562652 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide |
| SMILES | CC[C@@]1(C)C=CC(C(N)=O)=c2scnc2=C1 |
| InChI | InChI=1S/C12H14N2OS/c1-3-12(2)5-4-8(11(13)15)10-9(6-12)14-7-16-10/h4-7H,3H2,1-2H3,(H2,13,15)/t12-/m0/s1 |
| InChIKey | HHVJZRUNNVMKFQ-LBPRGKRZSA-N |
| XLogP | 0.55 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide?
The IUPAC name of (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide (CID 67562652) is (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide.
What is the SMILES notation for (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide?
The canonical SMILES for (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide is CC[C@@]1(C)C=CC(C(N)=O)=c2scnc2=C1.
What is the InChIKey of (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide?
The InChIKey is HHVJZRUNNVMKFQ-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H14N2OS/c1-3-12(2)5-4-8(11(13)15)10-9(6-12)14-7-16-10/h4-7H,3H2,1-2H3,(H2,13,15)/t12-/m0/s1.
What are the key properties of (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide?
(5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide has a molecular weight of 234.32 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-ethyl-5-methylcyclohepta[d][1,3]thiazole-8-carboxamide is sourced from PubChem (CID 67562652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).