About 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide
2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide (PubChem CID 67562659) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide |
| PubChem CID | 67562659 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide |
| SMILES | CC1=CCC=C(N(C)C(=O)CNC2CCCC2)C=C1 |
| InChI | InChI=1S/C16H24N2O/c1-13-6-5-9-15(11-10-13)18(2)16(19)12-17-14-7-3-4-8-14/h6,9-11,14,17H,3-5,7-8,12H2,1-2H3 |
| InChIKey | JESVIXJLJKIKDB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The IUPAC name of 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide (CID 67562659) is 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide.
What is the SMILES notation for 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The canonical SMILES for 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide is CC1=CCC=C(N(C)C(=O)CNC2CCCC2)C=C1.
What is the InChIKey of 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
The InChIKey is JESVIXJLJKIKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-13-6-5-9-15(11-10-13)18(2)16(19)12-17-14-7-3-4-8-14/h6,9-11,14,17H,3-5,7-8,12H2,1-2H3.
What are the key properties of 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide?
2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide has a molecular weight of 260.38 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylamino)-N-methyl-N-(5-methylcyclohepta-1,4,6-trien-1-yl)acetamide is sourced from PubChem (CID 67562659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).