C31H31N7O5 — CID 67563554
benzyl N-[amino-[4-[[[2-[6-(3-amino-5-hydroxyphenyl)-3-(cyclopropylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 67563554) has the molecular formula C31H31N7O5 and a molecular weight of 581.63 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[2-[6-(3-amino-5-hydroxyphenyl)-3-(cyclopropylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[2-[6-(3-amino-5-hydroxyphenyl)-3-(cyclopropylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 67563554 |
| Molecular Formula | C31H31N7O5 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | benzyl N-[amino-[4-[[[2-[6-(3-amino-5-hydroxyphenyl)-3-(cyclopropylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | NC(=NC(=O)OCc1ccccc1)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(O)c3)cnc(NC3CC3)c2=O)cc1 |
| InChI | InChI=1S/C31H31N7O5/c32-23-12-22(13-25(39)14-23)26-16-35-29(36-24-10-11-24)30(41)38(26)17-27(40)34-15-19-6-8-21(9-7-19)28(33)37-31(42)43-18-20-4-2-1-3-5-20/h1-9,12-14,16,24,39H,10-11,15,17-18,32H2,(H,34,40)(H,35,36)(H2,33,37,42) |
| InChIKey | AEGIISIVYJBIRJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 186.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|