C41H54O8 — CID 67563706
3-(4-hydroxyphenyl)-2-oxopropanoic acid;methyl acetate;[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] (E)-3-phenylprop-2-enoate (PubChem CID 67563706) has the molecular formula C41H54O8 and a molecular weight of 674.88 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-oxopropanoic acid;methyl acetate;[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | 3-(4-hydroxyphenyl)-2-oxopropanoic acid;methyl acetate;[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 67563706 |
| Molecular Formula | C41H54O8 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 674.38 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-oxopropanoic acid;methyl acetate;[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)OC(=O)/C=C/c1ccccc1.COC(C)=O.O=C(O)C(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C29H40O2.C9H8O4.C3H6O2/c1-23(2)12-10-14-25(5)18-20-28(22-26(6)15-11-13-24(3)4)31-29(30)21-19-27-16-8-7-9-17-27;10-7-3-1-6(2-4-7)5-8(11)9(12)13;1-3(4)5-2/h7-9,12-13,16-19,21-22,28H,10-11,14-15,20H2,1-6H3;1-4,10H,5H2,(H,12,13);1-2H3/b21-19+,25-18+,26-22+;; |
| InChIKey | BKBUUPLGYWXSIM-CXFUOBIQSA-N |
| XLogP | 9.15 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|