About 2,5-dimethylpyridine;thiolane
2,5-dimethylpyridine;thiolane (PubChem CID 67563776) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is 2,5-dimethylpyridine;thiolane.
Molecular Properties
| Compound Name | 2,5-dimethylpyridine;thiolane |
| PubChem CID | 67563776 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2,5-dimethylpyridine;thiolane |
| SMILES | C1CCSC1.Cc1ccc(C)nc1 |
| InChI | InChI=1S/C7H9N.C4H8S/c1-6-3-4-7(2)8-5-6;1-2-4-5-3-1/h3-5H,1-2H3;1-4H2 |
| InChIKey | NBCCUGZZQAGDQY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethylpyridine;thiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylpyridine;thiolane?
The IUPAC name of 2,5-dimethylpyridine;thiolane (CID 67563776) is 2,5-dimethylpyridine;thiolane.
What is the SMILES notation for 2,5-dimethylpyridine;thiolane?
The canonical SMILES for 2,5-dimethylpyridine;thiolane is C1CCSC1.Cc1ccc(C)nc1.
What is the InChIKey of 2,5-dimethylpyridine;thiolane?
The InChIKey is NBCCUGZZQAGDQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C4H8S/c1-6-3-4-7(2)8-5-6;1-2-4-5-3-1/h3-5H,1-2H3;1-4H2.
What are the key properties of 2,5-dimethylpyridine;thiolane?
2,5-dimethylpyridine;thiolane has a molecular weight of 195.33 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylpyridine;thiolane is sourced from PubChem (CID 67563776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).