About 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene
8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene (PubChem CID 67565515) has the molecular formula C9H11BrO2
and a molecular weight of 231.09 g/mol. Its IUPAC name is 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene.
Molecular Properties
| Compound Name | 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene |
| PubChem CID | 67565515 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene |
| SMILES | CC1(C)OC2(C=CC=C(Br)C2)O1 |
| InChI | InChI=1S/C9H11BrO2/c1-8(2)11-9(12-8)5-3-4-7(10)6-9/h3-5H,6H2,1-2H3 |
| InChIKey | VEMLCURENOFRQB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene?
The IUPAC name of 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene (CID 67565515) is 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene.
What is the SMILES notation for 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene?
The canonical SMILES for 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene is CC1(C)OC2(C=CC=C(Br)C2)O1.
What is the InChIKey of 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene?
The InChIKey is VEMLCURENOFRQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO2/c1-8(2)11-9(12-8)5-3-4-7(10)6-9/h3-5H,6H2,1-2H3.
What are the key properties of 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene?
8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene has a molecular weight of 231.09 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2,2-dimethyl-1,3-dioxaspiro[3.5]nona-5,7-diene is sourced from PubChem (CID 67565515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).