About methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate
methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate (PubChem CID 67566371) has the molecular formula C10H9ClO2S
and a molecular weight of 228.70 g/mol. Its IUPAC name is methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate |
| PubChem CID | 67566371 |
| Molecular Formula | C10H9ClO2S |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)C1Sc2ccccc2C1Cl |
| InChI | InChI=1S/C10H9ClO2S/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5,8-9H,1H3 |
| InChIKey | HXQUVRHHMIMXEX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate?
The IUPAC name of methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate (CID 67566371) is methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate?
The canonical SMILES for methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate is COC(=O)C1Sc2ccccc2C1Cl.
What is the InChIKey of methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate?
The InChIKey is HXQUVRHHMIMXEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO2S/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5,8-9H,1H3.
What are the key properties of methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate?
methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate has a molecular weight of 228.70 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloro-2,3-dihydro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 67566371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).