C9H15NO — CID 67566586
[(1S,3aR,7aS)-2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-yl]methanol (PubChem CID 67566586) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is [(1S,3aR,7aS)-2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-yl]methanol.
| Compound Name | [(1S,3aR,7aS)-2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-yl]methanol |
|---|---|
| PubChem CID | 67566586 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | [(1S,3aR,7aS)-2,3,3a,4,7,7a-hexahydro-1H-isoindol-1-yl]methanol |
| SMILES | OC[C@H]1NC[C@@H]2CC=CC[C@@H]21 |
| InChI | InChI=1S/C9H15NO/c11-6-9-8-4-2-1-3-7(8)5-10-9/h1-2,7-11H,3-6H2/t7-,8-,9+/m0/s1 |
| InChIKey | HFMFBZCNJXXUCG-XHNCKOQMSA-N |
| XLogP | 0.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|