About 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol
4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol (PubChem CID 67566752) has the molecular formula C31H49NO2
and a molecular weight of 467.74 g/mol. Its IUPAC name is 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol.
Molecular Properties
| Compound Name | 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol |
| PubChem CID | 67566752 |
| Molecular Formula | C31H49NO2 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.38 |
| IUPAC Name | 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol |
| SMILES | CCCCc1cc(CC(N)Cc2cc(CCCC)c(O)c(CCCC)c2)cc(CCCC)c1O |
| InChI | InChI=1S/C31H49NO2/c1-5-9-13-25-17-23(18-26(30(25)33)14-10-6-2)21-29(32)22-24-19-27(15-11-7-3)31(34)28(20-24)16-12-8-4/h17-20,29,33-34H,5-16,21-22,32H2,1-4H3 |
| InChIKey | DOIMWTRAMCQLRS-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol?
The IUPAC name of 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol (CID 67566752) is 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol.
What is the SMILES notation for 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol?
The canonical SMILES for 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol is CCCCc1cc(CC(N)Cc2cc(CCCC)c(O)c(CCCC)c2)cc(CCCC)c1O.
What is the InChIKey of 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol?
The InChIKey is DOIMWTRAMCQLRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H49NO2/c1-5-9-13-25-17-23(18-26(30(25)33)14-10-6-2)21-29(32)22-24-19-27(15-11-7-3)31(34)28(20-24)16-12-8-4/h17-20,29,33-34H,5-16,21-22,32H2,1-4H3.
What are the key properties of 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol?
4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol has a molecular weight of 467.74 g/mol, XLogP of 7.58, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-amino-3-(3,5-dibutyl-4-hydroxyphenyl)propyl]-2,6-dibutylphenol is sourced from PubChem (CID 67566752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).