C19H22N4O5 — CID 67567091
3-propyl-8-[2-(3,4,5-trimethoxyphenyl)ethenyl]-7H-purine-2,6-dione (PubChem CID 67567091) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-propyl-8-[2-(3,4,5-trimethoxyphenyl)ethenyl]-7H-purine-2,6-dione.
| Compound Name | 3-propyl-8-[2-(3,4,5-trimethoxyphenyl)ethenyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 67567091 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-propyl-8-[2-(3,4,5-trimethoxyphenyl)ethenyl]-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2[nH]c(C=Cc3cc(OC)c(OC)c(OC)c3)nc21 |
| InChI | InChI=1S/C19H22N4O5/c1-5-8-23-17-15(18(24)22-19(23)25)20-14(21-17)7-6-11-9-12(26-2)16(28-4)13(10-11)27-3/h6-7,9-10H,5,8H2,1-4H3,(H,20,21)(H,22,24,25) |
| InChIKey | ALBSDLFXZHITIK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |