C12H24O4Si — CID 67567253
(3S,3aR,6R,6aR)-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 67567253) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3S,3aR,6R,6aR)-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 67567253 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (3S,3aR,6R,6aR)-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | CC(C)(C[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O)[Si](C)(C)O |
| InChI | InChI=1S/C12H24O4Si/c1-12(2,17(3,4)14)5-8-6-15-11-9(13)7-16-10(8)11/h8-11,13-14H,5-7H2,1-4H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | MCXGTQPSPMMELH-LNFKQOIKSA-N |
| XLogP | 1.13 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|