C22H44O7Si2 — CID 67567645
(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethyl-4-hydroxycyclohexane-1,1-dicarboxylic acid (PubChem CID 67567645) has the molecular formula C22H44O7Si2 and a molecular weight of 476.76 g/mol. Its IUPAC name is (3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethyl-4-hydroxycyclohexane-1,1-dicarboxylic acid.
| Compound Name | (3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethyl-4-hydroxycyclohexane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 67567645 |
| Molecular Formula | C22H44O7Si2 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethyl-4-hydroxycyclohexane-1,1-dicarboxylic acid |
| SMILES | CCC1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)CC1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H44O7Si2/c1-12-14-17(29-31(10,11)21(5,6)7)16(23)15(28-30(8,9)20(2,3)4)13-22(14,18(24)25)19(26)27/h14-17,23H,12-13H2,1-11H3,(H,24,25)(H,26,27)/t14?,15-,16-,17-/m1/s1 |
| InChIKey | QTXHXPZBJMCBJT-XMMHPARDSA-N |
| XLogP | 4.71 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|