About 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine
2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine (PubChem CID 675677) has the molecular formula C15H18N2O2S2
and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine |
| PubChem CID | 675677 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(SCCS(=O)(=O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-12-10-13(2)17-15(16-12)20-8-9-21(18,19)11-14-6-4-3-5-7-14/h3-7,10H,8-9,11H2,1-2H3 |
| InChIKey | OZOITVHSOCKZMF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine?
The IUPAC name of 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine (CID 675677) is 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine.
What is the SMILES notation for 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine?
The canonical SMILES for 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine is Cc1cc(C)nc(SCCS(=O)(=O)Cc2ccccc2)n1.
What is the InChIKey of 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine?
The InChIKey is OZOITVHSOCKZMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S2/c1-12-10-13(2)17-15(16-12)20-8-9-21(18,19)11-14-6-4-3-5-7-14/h3-7,10H,8-9,11H2,1-2H3.
What are the key properties of 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine?
2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine has a molecular weight of 322.46 g/mol, XLogP of 2.80, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine is sourced from PubChem (CID 675677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).