C15H18N2O2S2 — CID 675677
2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine (PubChem CID 675677) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine.
| Compound Name | 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 675677 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-(2-benzylsulfonylethylsulfanyl)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(SCCS(=O)(=O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-12-10-13(2)17-15(16-12)20-8-9-21(18,19)11-14-6-4-3-5-7-14/h3-7,10H,8-9,11H2,1-2H3 |
| InChIKey | OZOITVHSOCKZMF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |