About 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione
7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione (PubChem CID 67567721) has the molecular formula C18H22N4O2S
and a molecular weight of 358.47 g/mol. Its IUPAC name is 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione.
Molecular Properties
| Compound Name | 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione |
| PubChem CID | 67567721 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(C=Cc3cccs3)n2C)n(CCC)c1=O |
| InChI | InChI=1S/C18H22N4O2S/c1-4-10-21-16-15(17(23)22(11-5-2)18(21)24)20(3)14(19-16)9-8-13-7-6-12-25-13/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | FKKHQVNLSKFCPS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione?
The IUPAC name of 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione (CID 67567721) is 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione.
What is the SMILES notation for 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione?
The canonical SMILES for 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione is CCCn1c(=O)c2c(nc(C=Cc3cccs3)n2C)n(CCC)c1=O.
What is the InChIKey of 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione?
The InChIKey is FKKHQVNLSKFCPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2S/c1-4-10-21-16-15(17(23)22(11-5-2)18(21)24)20(3)14(19-16)9-8-13-7-6-12-25-13/h6-9,12H,4-5,10-11H2,1-3H3.
What are the key properties of 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione?
7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione has a molecular weight of 358.47 g/mol, XLogP of 2.95, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,3-dipropyl-8-(2-thiophen-2-ylethenyl)purine-2,6-dione is sourced from PubChem (CID 67567721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).