About 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one
1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one (PubChem CID 67568393) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one.
Molecular Properties
| Compound Name | 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one |
| PubChem CID | 67568393 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one |
| SMILES | CC(=O)CC1(OCCO)C=CC=CC1(C)O |
| InChI | InChI=1S/C12H18O4/c1-10(14)9-12(16-8-7-13)6-4-3-5-11(12,2)15/h3-6,13,15H,7-9H2,1-2H3 |
| InChIKey | INJBCFHDEFCPKE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one?
The IUPAC name of 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one (CID 67568393) is 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one.
What is the SMILES notation for 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one?
The canonical SMILES for 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one is CC(=O)CC1(OCCO)C=CC=CC1(C)O.
What is the InChIKey of 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one?
The InChIKey is INJBCFHDEFCPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-10(14)9-12(16-8-7-13)6-4-3-5-11(12,2)15/h3-6,13,15H,7-9H2,1-2H3.
What are the key properties of 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one?
1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one has a molecular weight of 226.27 g/mol, XLogP of 0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-hydroxy-1-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]propan-2-one is sourced from PubChem (CID 67568393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).