About 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione
2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione (PubChem CID 67568449) has the molecular formula C9H16N4O4
and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 67568449 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cc1c[nH]c(=O)[nH]c1=O.NCCNCC(=O)O |
| InChI | InChI=1S/C5H6N2O2.C4H10N2O2/c1-3-2-6-5(9)7-4(3)8;5-1-2-6-3-4(7)8/h2H,1H3,(H2,6,7,8,9);6H,1-3,5H2,(H,7,8) |
| InChIKey | ALRDSVHRMIWNBW-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione?
The IUPAC name of 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione (CID 67568449) is 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione is Cc1c[nH]c(=O)[nH]c1=O.NCCNCC(=O)O.
What is the InChIKey of 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione?
The InChIKey is ALRDSVHRMIWNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2.C4H10N2O2/c1-3-2-6-5(9)7-4(3)8;5-1-2-6-3-4(7)8/h2H,1H3,(H2,6,7,8,9);6H,1-3,5H2,(H,7,8).
What are the key properties of 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione?
2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione has a molecular weight of 244.25 g/mol, XLogP of -2.01, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethylamino)acetic acid;5-methyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 67568449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).