C12H14N2O2 — CID 67568661
8-methoxy-3,4,10,10a-tetrahydro-2H-pyrazino[1,2-a]indol-1-one (PubChem CID 67568661) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 8-methoxy-3,4,10,10a-tetrahydro-2H-pyrazino[1,2-a]indol-1-one.
| Compound Name | 8-methoxy-3,4,10,10a-tetrahydro-2H-pyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 67568661 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 8-methoxy-3,4,10,10a-tetrahydro-2H-pyrazino[1,2-a]indol-1-one |
| SMILES | COc1ccc2c(c1)CC1C(=O)NCCN21 |
| InChI | InChI=1S/C12H14N2O2/c1-16-9-2-3-10-8(6-9)7-11-12(15)13-4-5-14(10)11/h2-3,6,11H,4-5,7H2,1H3,(H,13,15) |
| InChIKey | OXSLTLUXYLHNLM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|