C18H13Cl2NO2 — CID 67568917
(1S,3R)-1-(3,4-dichlorophenyl)spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione (PubChem CID 67568917) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is (1S,3R)-1-(3,4-dichlorophenyl)spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione.
| Compound Name | (1S,3R)-1-(3,4-dichlorophenyl)spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 67568917 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (1S,3R)-1-(3,4-dichlorophenyl)spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione |
| SMILES | O=C1C[C@@]2(C[C@@H](c3ccc(Cl)c(Cl)c3)c3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C18H13Cl2NO2/c19-14-6-5-10(7-15(14)20)12-8-18(9-16(22)21-17(18)23)13-4-2-1-3-11(12)13/h1-7,12H,8-9H2,(H,21,22,23)/t12-,18+/m0/s1 |
| InChIKey | YZUAPXAKLPKBFT-KPZWWZAWSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|