About 3H-dithiole 1,1-dioxide
3H-dithiole 1,1-dioxide (PubChem CID 67569235) has the molecular formula C3H4O2S2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 3H-dithiole 1,1-dioxide.
Molecular Properties
| Compound Name | 3H-dithiole 1,1-dioxide |
| PubChem CID | 67569235 |
| Molecular Formula | C3H4O2S2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 135.97 |
| IUPAC Name | 3H-dithiole 1,1-dioxide |
| SMILES | O=S1(=O)C=CCS1 |
| InChI | InChI=1S/C3H4O2S2/c4-7(5)3-1-2-6-7/h1,3H,2H2 |
| InChIKey | OXNYUFFKBRECDZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3H-dithiole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-dithiole 1,1-dioxide?
The IUPAC name of 3H-dithiole 1,1-dioxide (CID 67569235) is 3H-dithiole 1,1-dioxide.
What is the SMILES notation for 3H-dithiole 1,1-dioxide?
The canonical SMILES for 3H-dithiole 1,1-dioxide is O=S1(=O)C=CCS1.
What is the InChIKey of 3H-dithiole 1,1-dioxide?
The InChIKey is OXNYUFFKBRECDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2S2/c4-7(5)3-1-2-6-7/h1,3H,2H2.
What are the key properties of 3H-dithiole 1,1-dioxide?
3H-dithiole 1,1-dioxide has a molecular weight of 136.20 g/mol, XLogP of 0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-dithiole 1,1-dioxide is sourced from PubChem (CID 67569235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).