C13H17ClN6O7S — CID 67569488
5-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-chloro-1,2-dimethyl-3H-pyrazole-4-carboxylic acid (PubChem CID 67569488) has the molecular formula C13H17ClN6O7S and a molecular weight of 436.83 g/mol. Its IUPAC name is 5-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-chloro-1,2-dimethyl-3H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-chloro-1,2-dimethyl-3H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67569488 |
| Molecular Formula | C13H17ClN6O7S |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 5-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-chloro-1,2-dimethyl-3H-pyrazole-4-carboxylic acid |
| SMILES | COc1cc(OC)nc(N(C(N)=O)S(=O)(=O)C2=C(C(=O)O)C(Cl)N(C)N2C)n1 |
| InChI | InChI=1S/C13H17ClN6O7S/c1-18-9(14)8(11(21)22)10(19(18)2)28(24,25)20(12(15)23)13-16-6(26-3)5-7(17-13)27-4/h5,9H,1-4H3,(H2,15,23)(H,21,22) |
| InChIKey | XJSJPBWOQVPTTI-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|