C17H12FN3 — CID 67569582
4-[(2-fluoro-4-pyridinyl)methyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 67569582) has the molecular formula C17H12FN3 and a molecular weight of 277.30 g/mol. Its IUPAC name is 4-[(2-fluoro-4-pyridinyl)methyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-[(2-fluoro-4-pyridinyl)methyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 67569582 |
| Molecular Formula | C17H12FN3 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-[(2-fluoro-4-pyridinyl)methyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Fc1cc(Cc2ccc3c(n2)-c2ncccc2C3)ccn1 |
| InChI | InChI=1S/C17H12FN3/c18-15-9-11(5-7-19-15)8-14-4-3-13-10-12-2-1-6-20-16(12)17(13)21-14/h1-7,9H,8,10H2 |
| InChIKey | WBXWSCSGVWETKJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|