C20H12Cl2N2O5 — CID 67570326
5,6-diamino-4,7-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 67570326) has the molecular formula C20H12Cl2N2O5 and a molecular weight of 431.23 g/mol. Its IUPAC name is 5,6-diamino-4,7-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 5,6-diamino-4,7-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 67570326 |
| Molecular Formula | C20H12Cl2N2O5 |
| Molecular Weight | 431.23 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 5,6-diamino-4,7-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Nc1c(N)c(Cl)c2c(c1Cl)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C20H12Cl2N2O5/c21-15-13-14(16(22)18(24)17(15)23)20(29-19(13)27)9-3-1-7(25)5-11(9)28-12-6-8(26)2-4-10(12)20/h1-6,25-26H,23-24H2 |
| InChIKey | DBNNRCLRKSHVDK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|