C34H38N2O3 — CID 67570705
1-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-4-phenylbutan-1-one;4-methylbenzoic acid (PubChem CID 67570705) has the molecular formula C34H38N2O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is 1-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-4-phenylbutan-1-one;4-methylbenzoic acid.
| Compound Name | 1-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-4-phenylbutan-1-one;4-methylbenzoic acid |
|---|---|
| PubChem CID | 67570705 |
| Molecular Formula | C34H38N2O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 1-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-4-phenylbutan-1-one;4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1.O=C(CCCc1ccccc1)c1ccc2[nH]cc(C3CCN4CCCC4C3)c2c1 |
| InChI | InChI=1S/C26H30N2O.C8H8O2/c29-26(10-4-8-19-6-2-1-3-7-19)21-11-12-25-23(17-21)24(18-27-25)20-13-15-28-14-5-9-22(28)16-20;1-6-2-4-7(5-3-6)8(9)10/h1-3,6-7,11-12,17-18,20,22,27H,4-5,8-10,13-16H2;2-5H,1H3,(H,9,10) |
| InChIKey | SCWYYJBLIJFKCR-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |