C31H28ClF3N2O3 — CID 67570743
[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-[2-(trifluoromethyl)phenyl]methanone;2-chlorobenzoic acid (PubChem CID 67570743) has the molecular formula C31H28ClF3N2O3 and a molecular weight of 569.02 g/mol. Its IUPAC name is [3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-[2-(trifluoromethyl)phenyl]methanone;2-chlorobenzoic acid.
| Compound Name | [3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-[2-(trifluoromethyl)phenyl]methanone;2-chlorobenzoic acid |
|---|---|
| PubChem CID | 67570743 |
| Molecular Formula | C31H28ClF3N2O3 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | [3-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-indol-5-yl]-[2-(trifluoromethyl)phenyl]methanone;2-chlorobenzoic acid |
| SMILES | O=C(O)c1ccccc1Cl.O=C(c1ccc2[nH]cc(C3CCN4CCCC4C3)c2c1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H23F3N2O.C7H5ClO2/c25-24(26,27)21-6-2-1-5-18(21)23(30)16-7-8-22-19(13-16)20(14-28-22)15-9-11-29-10-3-4-17(29)12-15;8-6-4-2-1-3-5(6)7(9)10/h1-2,5-8,13-15,17,28H,3-4,9-12H2;1-4H,(H,9,10) |
| InChIKey | PRZXLYXVLKPYOP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |