C13H13N3O2S — CID 67570814
3-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)benzenesulfonamide (PubChem CID 67570814) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)benzenesulfonamide.
| Compound Name | 3-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 67570814 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2cnc3c(c2)CCN3)c1 |
| InChI | InChI=1S/C13H13N3O2S/c14-19(17,18)12-3-1-2-9(7-12)11-6-10-4-5-15-13(10)16-8-11/h1-3,6-8H,4-5H2,(H,15,16)(H2,14,17,18) |
| InChIKey | USGHJQFGEDHEBX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |