C28H29N3O3P+ — CID 67571019
dihydroxy(oxo)phosphanium;3-(3-ethylpent-1-ynyl)-1-trityl-1,2,4-triazole (PubChem CID 67571019) has the molecular formula C28H29N3O3P+ and a molecular weight of 486.53 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;3-(3-ethylpent-1-ynyl)-1-trityl-1,2,4-triazole.
| Compound Name | dihydroxy(oxo)phosphanium;3-(3-ethylpent-1-ynyl)-1-trityl-1,2,4-triazole |
|---|---|
| PubChem CID | 67571019 |
| Molecular Formula | C28H29N3O3P+ |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | dihydroxy(oxo)phosphanium;3-(3-ethylpent-1-ynyl)-1-trityl-1,2,4-triazole |
| SMILES | CCC(C#Cc1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1)CC.O=[P+](O)O |
| InChI | InChI=1S/C28H27N3.HO3P/c1-3-23(4-2)20-21-27-29-22-31(30-27)28(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26;1-4(2)3/h5-19,22-23H,3-4H2,1-2H3;(H-,1,2,3)/p+1 |
| InChIKey | DRVKIDBNQMJIHF-UHFFFAOYSA-O |
| XLogP | 5.53 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|