About [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid
[(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid (PubChem CID 67571182) has the molecular formula C5H7FN3O3P
and a molecular weight of 207.10 g/mol. Its IUPAC name is [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid.
Molecular Properties
| Compound Name | [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid |
| PubChem CID | 67571182 |
| Molecular Formula | C5H7FN3O3P |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)/C=C/c1ncn[nH]1 |
| InChI | InChI=1S/C5H7FN3O3P/c6-4(13(10,11)12)1-2-5-7-3-8-9-5/h1-4H,(H,7,8,9)(H2,10,11,12)/b2-1+ |
| InChIKey | REUGIXGWRRFGON-OWOJBTEDSA-N |
| XLogP | 0.29 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid?
The IUPAC name of [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid (CID 67571182) is [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid.
What is the SMILES notation for [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid?
The canonical SMILES for [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid is O=P(O)(O)C(F)/C=C/c1ncn[nH]1.
What is the InChIKey of [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid?
The InChIKey is REUGIXGWRRFGON-OWOJBTEDSA-N. The full InChI is InChI=1S/C5H7FN3O3P/c6-4(13(10,11)12)1-2-5-7-3-8-9-5/h1-4H,(H,7,8,9)(H2,10,11,12)/b2-1+.
What are the key properties of [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid?
[(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid has a molecular weight of 207.10 g/mol, XLogP of 0.29, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-fluoro-3-(1H-1,2,4-triazol-5-yl)prop-2-enyl]phosphonic acid is sourced from PubChem (CID 67571182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).