C5H8FN3O3P+ — CID 67571186
dihydroxy(oxo)phosphanium;5-(3-fluoroprop-1-enyl)-1H-1,2,4-triazole (PubChem CID 67571186) has the molecular formula C5H8FN3O3P+ and a molecular weight of 208.11 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;5-(3-fluoroprop-1-enyl)-1H-1,2,4-triazole.
| Compound Name | dihydroxy(oxo)phosphanium;5-(3-fluoroprop-1-enyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 67571186 |
| Molecular Formula | C5H8FN3O3P+ |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | dihydroxy(oxo)phosphanium;5-(3-fluoroprop-1-enyl)-1H-1,2,4-triazole |
| SMILES | FCC=Cc1ncn[nH]1.O=[P+](O)O |
| InChI | InChI=1S/C5H6FN3.HO3P/c6-3-1-2-5-7-4-8-9-5;1-4(2)3/h1-2,4H,3H2,(H,7,8,9);(H-,1,2,3)/p+1 |
| InChIKey | ANHNMFFIICPOCA-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|