C16H22N2 — CID 67571290
4-(3,5-dimethylphenyl)-2,6-dimethylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 67571290) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-2,6-dimethylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-(3,5-dimethylphenyl)-2,6-dimethylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 67571290 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-2,6-dimethylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | CC1=CC(c2cc(C)cc(C)c2)=CC(C)C1(N)N |
| InChI | InChI=1S/C16H22N2/c1-10-5-11(2)7-14(6-10)15-8-12(3)16(17,18)13(4)9-15/h5-9,12H,17-18H2,1-4H3 |
| InChIKey | KQSDYCPSESGZGY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|