About 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol
3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol (PubChem CID 67571305) has the molecular formula C5H8FN3O
and a molecular weight of 145.14 g/mol. Its IUPAC name is 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol |
| PubChem CID | 67571305 |
| Molecular Formula | C5H8FN3O |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol |
| SMILES | OC(CCF)c1ncn[nH]1 |
| InChI | InChI=1S/C5H8FN3O/c6-2-1-4(10)5-7-3-8-9-5/h3-4,10H,1-2H2,(H,7,8,9) |
| InChIKey | CWUXXKXDKYJJGW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol?
The IUPAC name of 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol (CID 67571305) is 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol.
What is the SMILES notation for 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol?
The canonical SMILES for 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol is OC(CCF)c1ncn[nH]1.
What is the InChIKey of 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol?
The InChIKey is CWUXXKXDKYJJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN3O/c6-2-1-4(10)5-7-3-8-9-5/h3-4,10H,1-2H2,(H,7,8,9).
What are the key properties of 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol?
3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol has a molecular weight of 145.14 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1-(1H-1,2,4-triazol-5-yl)propan-1-ol is sourced from PubChem (CID 67571305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).