C16H18F3N5 — CID 67571343
2-[phenyl-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 67571343) has the molecular formula C16H18F3N5 and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-[phenyl-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | 2-[phenyl-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 67571343 |
| Molecular Formula | C16H18F3N5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[phenyl-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | NC1=NC(C(c2ccccc2)c2nc(C(F)(F)F)n[nH]2)CCCC1 |
| InChI | InChI=1S/C16H18F3N5/c17-16(18,19)15-22-14(23-24-15)13(10-6-2-1-3-7-10)11-8-4-5-9-12(20)21-11/h1-3,6-7,11,13H,4-5,8-9H2,(H2,20,21)(H,22,23,24) |
| InChIKey | CQHDBRNSBWKLMK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |