About dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole
dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole (PubChem CID 67571820) has the molecular formula C5H9N3O3P+
and a molecular weight of 190.12 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole |
| PubChem CID | 67571820 |
| Molecular Formula | C5H9N3O3P+ |
| Molecular Weight | 190.12 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole |
| SMILES | CC=Cc1ncn[nH]1.O=[P+](O)O |
| InChI | InChI=1S/C5H7N3.HO3P/c1-2-3-5-6-4-7-8-5;1-4(2)3/h2-4H,1H3,(H,6,7,8);(H-,1,2,3)/p+1 |
| InChIKey | XHUZSQJNEHRPQK-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.12 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole?
The IUPAC name of dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole (CID 67571820) is dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole.
What is the SMILES notation for dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole?
The canonical SMILES for dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole is CC=Cc1ncn[nH]1.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole?
The InChIKey is XHUZSQJNEHRPQK-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H7N3.HO3P/c1-2-3-5-6-4-7-8-5;1-4(2)3/h2-4H,1H3,(H,6,7,8);(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole?
dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole has a molecular weight of 190.12 g/mol, XLogP of 0.47, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;5-prop-1-enyl-1H-1,2,4-triazole is sourced from PubChem (CID 67571820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).