About (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite
(2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite (PubChem CID 67572266) has the molecular formula C23H24FO4P
and a molecular weight of 414.41 g/mol. Its IUPAC name is (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite.
Molecular Properties
| Compound Name | (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite |
| PubChem CID | 67572266 |
| Molecular Formula | C23H24FO4P |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite |
| SMILES | Cc1cc(Oc2ccccc2)cc(C(C)(C)C)c1OP(OF)Oc1ccccc1 |
| InChI | InChI=1S/C23H24FO4P/c1-17-15-20(25-18-11-7-5-8-12-18)16-21(23(2,3)4)22(17)27-29(28-24)26-19-13-9-6-10-14-19/h5-16H,1-4H3 |
| InChIKey | SXZRKJASCQPYPG-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite?
The IUPAC name of (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite (CID 67572266) is (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite.
What is the SMILES notation for (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite?
The canonical SMILES for (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite is Cc1cc(Oc2ccccc2)cc(C(C)(C)C)c1OP(OF)Oc1ccccc1.
What is the InChIKey of (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite?
The InChIKey is SXZRKJASCQPYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24FO4P/c1-17-15-20(25-18-11-7-5-8-12-18)16-21(23(2,3)4)22(17)27-29(28-24)26-19-13-9-6-10-14-19/h5-16H,1-4H3.
What are the key properties of (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite?
(2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite has a molecular weight of 414.41 g/mol, XLogP of 7.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-6-methyl-4-phenoxyphenyl) fluoro phenyl phosphite is sourced from PubChem (CID 67572266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).