About tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate
tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 67572548) has the molecular formula C32H38N2O2
and a molecular weight of 482.67 g/mol. Its IUPAC name is tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| PubChem CID | 67572548 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | Cc1cc2nc(CC(C)(C)C)n(Cc3ccc(-c4ccccc4C(=O)OC(C)(C)C)cc3)c2cc1C |
| InChI | InChI=1S/C32H38N2O2/c1-21-17-27-28(18-22(21)2)34(29(33-27)19-31(3,4)5)20-23-13-15-24(16-14-23)25-11-9-10-12-26(25)30(35)36-32(6,7)8/h9-18H,19-20H2,1-8H3 |
| InChIKey | HOJKCGUTNJOILT-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate?
The IUPAC name of tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate (CID 67572548) is tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate.
What is the SMILES notation for tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate?
The canonical SMILES for tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate is Cc1cc2nc(CC(C)(C)C)n(Cc3ccc(-c4ccccc4C(=O)OC(C)(C)C)cc3)c2cc1C.
What is the InChIKey of tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate?
The InChIKey is HOJKCGUTNJOILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H38N2O2/c1-21-17-27-28(18-22(21)2)34(29(33-27)19-31(3,4)5)20-23-13-15-24(16-14-23)25-11-9-10-12-26(25)30(35)36-32(6,7)8/h9-18H,19-20H2,1-8H3.
What are the key properties of tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate?
tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate has a molecular weight of 482.67 g/mol, XLogP of 7.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-[[2-(2,2-dimethylpropyl)-5,6-dimethylbenzimidazol-1-yl]methyl]phenyl]benzoate is sourced from PubChem (CID 67572548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).