About ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate
ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate (PubChem CID 67572848) has the molecular formula C20H24N2O6
and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate.
Molecular Properties
| Compound Name | ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate |
| PubChem CID | 67572848 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)CCCCCN2C(=O)C=CC2=O)cc1O |
| InChI | InChI=1S/C20H24N2O6/c1-2-28-20(27)15-8-7-14(12-16(15)23)13-21-17(24)6-4-3-5-11-22-18(25)9-10-19(22)26/h7-10,12,23H,2-6,11,13H2,1H3,(H,21,24) |
| InChIKey | HQPBVJGMCYUCCA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate?
The IUPAC name of ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate (CID 67572848) is ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate.
What is the SMILES notation for ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate?
The canonical SMILES for ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate is CCOC(=O)c1ccc(CNC(=O)CCCCCN2C(=O)C=CC2=O)cc1O.
What is the InChIKey of ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate?
The InChIKey is HQPBVJGMCYUCCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O6/c1-2-28-20(27)15-8-7-14(12-16(15)23)13-21-17(24)6-4-3-5-11-22-18(25)9-10-19(22)26/h7-10,12,23H,2-6,11,13H2,1H3,(H,21,24).
What are the key properties of ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate?
ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate has a molecular weight of 388.42 g/mol, XLogP of 1.67, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]-2-hydroxybenzoate is sourced from PubChem (CID 67572848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).