About bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium
bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium (PubChem CID 67573152) has the molecular formula C40H55BNO3+
and a molecular weight of 608.70 g/mol. Its IUPAC name is bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium.
Molecular Properties
| Compound Name | bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium |
| PubChem CID | 67573152 |
| Molecular Formula | C40H55BNO3+ |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.OB(OCCCC(c1ccccc1)c1ccccc1)OCCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H35BO3.C8H20N/c34-33(35-25-13-23-31(27-15-5-1-6-16-27)28-17-7-2-8-18-28)36-26-14-24-32(29-19-9-3-10-20-29)30-21-11-4-12-22-30;1-5-9(6-2,7-3)8-4/h1-12,15-22,31-32,34H,13-14,23-26H2;5-8H2,1-4H3/q;+1 |
| InChIKey | NUFUQTNBSNKLOO-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium?
The IUPAC name of bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium (CID 67573152) is bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium.
What is the SMILES notation for bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium?
The canonical SMILES for bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium is CC[N+](CC)(CC)CC.OB(OCCCC(c1ccccc1)c1ccccc1)OCCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium?
The InChIKey is NUFUQTNBSNKLOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H35BO3.C8H20N/c34-33(35-25-13-23-31(27-15-5-1-6-16-27)28-17-7-2-8-18-28)36-26-14-24-32(29-19-9-3-10-20-29)30-21-11-4-12-22-30;1-5-9(6-2,7-3)8-4/h1-12,15-22,31-32,34H,13-14,23-26H2;5-8H2,1-4H3/q;+1.
What are the key properties of bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium?
bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium has a molecular weight of 608.70 g/mol, XLogP of 9.10, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,4-diphenylbutoxy)borinic acid;tetraethylazanium is sourced from PubChem (CID 67573152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).