About bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride
bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride (PubChem CID 67573176) has the molecular formula C25H48Cl2N4O3
and a molecular weight of 523.59 g/mol. Its IUPAC name is bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride.
Molecular Properties
| Compound Name | bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride |
| PubChem CID | 67573176 |
| Molecular Formula | C25H48Cl2N4O3 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride |
| SMILES | Cl.Cl.O=C(OCC(N1CCCCC1)N1CCCCC1)OCC(N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C25H46N4O3.2ClH/c30-25(31-21-23(26-13-5-1-6-14-26)27-15-7-2-8-16-27)32-22-24(28-17-9-3-10-18-28)29-19-11-4-12-20-29;;/h23-24H,1-22H2;2*1H |
| InChIKey | GAVWADLPMXLTMK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride?
The IUPAC name of bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride (CID 67573176) is bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride.
What is the SMILES notation for bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride?
The canonical SMILES for bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride is Cl.Cl.O=C(OCC(N1CCCCC1)N1CCCCC1)OCC(N1CCCCC1)N1CCCCC1.
What is the InChIKey of bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride?
The InChIKey is GAVWADLPMXLTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H46N4O3.2ClH/c30-25(31-21-23(26-13-5-1-6-14-26)27-15-7-2-8-16-27)32-22-24(28-17-9-3-10-18-28)29-19-11-4-12-20-29;;/h23-24H,1-22H2;2*1H.
What are the key properties of bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride?
bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride has a molecular weight of 523.59 g/mol, XLogP of 4.58, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,2-di(piperidin-1-yl)ethyl] carbonate;dihydrochloride is sourced from PubChem (CID 67573176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).