C32H46BBrN2O4 — CID 67573265
5-bromo-2-(4-octoxyphenyl)pyrimidine;(4-octoxyphenyl)boronic acid (PubChem CID 67573265) has the molecular formula C32H46BBrN2O4 and a molecular weight of 613.45 g/mol. Its IUPAC name is 5-bromo-2-(4-octoxyphenyl)pyrimidine;(4-octoxyphenyl)boronic acid.
| Compound Name | 5-bromo-2-(4-octoxyphenyl)pyrimidine;(4-octoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 67573265 |
| Molecular Formula | C32H46BBrN2O4 |
| Molecular Weight | 613.45 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 5-bromo-2-(4-octoxyphenyl)pyrimidine;(4-octoxyphenyl)boronic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ncc(Br)cn2)cc1.CCCCCCCCOc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C18H23BrN2O.C14H23BO3/c1-2-3-4-5-6-7-12-22-17-10-8-15(9-11-17)18-20-13-16(19)14-21-18;1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17/h8-11,13-14H,2-7,12H2,1H3;8-11,16-17H,2-7,12H2,1H3 |
| InChIKey | FYKLRNLMOHOFFM-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.45 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|