About 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol
6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol (PubChem CID 67573367) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol.
Molecular Properties
| Compound Name | 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol |
| PubChem CID | 67573367 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol |
| SMILES | CCC1CC(C)(O)C(N(C)CCO)C(C)O1 |
| InChI | InChI=1S/C12H25NO3/c1-5-10-8-12(3,15)11(9(2)16-10)13(4)6-7-14/h9-11,14-15H,5-8H2,1-4H3 |
| InChIKey | AZZSOQUORUCZGK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol?
The IUPAC name of 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol (CID 67573367) is 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol.
What is the SMILES notation for 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol?
The canonical SMILES for 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol is CCC1CC(C)(O)C(N(C)CCO)C(C)O1.
What is the InChIKey of 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol?
The InChIKey is AZZSOQUORUCZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-5-10-8-12(3,15)11(9(2)16-10)13(4)6-7-14/h9-11,14-15H,5-8H2,1-4H3.
What are the key properties of 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol?
6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol has a molecular weight of 231.34 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-[2-hydroxyethyl(methyl)amino]-2,4-dimethyloxan-4-ol is sourced from PubChem (CID 67573367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).