About ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate
ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate (PubChem CID 67573414) has the molecular formula C19H18F2N2O3S2
and a molecular weight of 424.49 g/mol. Its IUPAC name is ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate |
| PubChem CID | 67573414 |
| Molecular Formula | C19H18F2N2O3S2 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(Cc1nc2ccc(F)c(F)c2s1)c1sccc1C |
| InChI | InChI=1S/C19H18F2N2O3S2/c1-3-26-16(25)7-6-15(24)23(19-11(2)8-9-27-19)10-14-22-13-5-4-12(20)17(21)18(13)28-14/h4-5,8-9H,3,6-7,10H2,1-2H3 |
| InChIKey | NDJSNWRWESWHPK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate?
The IUPAC name of ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate (CID 67573414) is ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate.
What is the SMILES notation for ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate?
The canonical SMILES for ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate is CCOC(=O)CCC(=O)N(Cc1nc2ccc(F)c(F)c2s1)c1sccc1C.
What is the InChIKey of ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate?
The InChIKey is NDJSNWRWESWHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F2N2O3S2/c1-3-26-16(25)7-6-15(24)23(19-11(2)8-9-27-19)10-14-22-13-5-4-12(20)17(21)18(13)28-14/h4-5,8-9H,3,6-7,10H2,1-2H3.
What are the key properties of ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate?
ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate has a molecular weight of 424.49 g/mol, XLogP of 4.82, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl-(3-methylthiophen-2-yl)amino]-4-oxobutanoate is sourced from PubChem (CID 67573414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).