About bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride
bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride (PubChem CID 67573551) has the molecular formula C21H40Cl2N4O7
and a molecular weight of 531.48 g/mol. Its IUPAC name is bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride.
Molecular Properties
| Compound Name | bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride |
| PubChem CID | 67573551 |
| Molecular Formula | C21H40Cl2N4O7 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride |
| SMILES | Cl.Cl.O=C(OCC(N1CCOCC1)N1CCOCC1)OCC(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C21H38N4O7.2ClH/c26-21(31-17-19(22-1-9-27-10-2-22)23-3-11-28-12-4-23)32-18-20(24-5-13-29-14-6-24)25-7-15-30-16-8-25;;/h19-20H,1-18H2;2*1H |
| InChIKey | QNXPZSPCVNGMIV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 85.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride?
The IUPAC name of bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride (CID 67573551) is bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride.
What is the SMILES notation for bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride?
The canonical SMILES for bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride is Cl.Cl.O=C(OCC(N1CCOCC1)N1CCOCC1)OCC(N1CCOCC1)N1CCOCC1.
What is the InChIKey of bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride?
The InChIKey is QNXPZSPCVNGMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N4O7.2ClH/c26-21(31-17-19(22-1-9-27-10-2-22)23-3-11-28-12-4-23)32-18-20(24-5-13-29-14-6-24)25-7-15-30-16-8-25;;/h19-20H,1-18H2;2*1H.
What are the key properties of bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride?
bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride has a molecular weight of 531.48 g/mol, XLogP of -0.04, 8 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimorpholin-4-ylethyl) carbonate;dihydrochloride is sourced from PubChem (CID 67573551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).