About bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate
bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate (PubChem CID 67573922) has the molecular formula C44H62BO3P
and a molecular weight of 680.76 g/mol. Its IUPAC name is bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate.
Molecular Properties
| Compound Name | bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate |
| PubChem CID | 67573922 |
| Molecular Formula | C44H62BO3P |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.45 |
| IUPAC Name | bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate |
| SMILES | CCP(CC)(CC)(CC)OB(OCCCC(c1ccc(C)cc1)c1ccc(C)cc1)OCCCC(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C44H62BO3P/c1-9-49(10-2,11-3,12-4)48-45(46-33-13-15-43(39-25-17-35(5)18-26-39)40-27-19-36(6)20-28-40)47-34-14-16-44(41-29-21-37(7)22-30-41)42-31-23-38(8)24-32-42/h17-32,43-44H,9-16,33-34H2,1-8H3 |
| InChIKey | DTJKZQVLPMSRCO-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate?
The IUPAC name of bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate (CID 67573922) is bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate.
What is the SMILES notation for bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate?
The canonical SMILES for bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate is CCP(CC)(CC)(CC)OB(OCCCC(c1ccc(C)cc1)c1ccc(C)cc1)OCCCC(c1ccc(C)cc1)c1ccc(C)cc1.
What is the InChIKey of bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate?
The InChIKey is DTJKZQVLPMSRCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H62BO3P/c1-9-49(10-2,11-3,12-4)48-45(46-33-13-15-43(39-25-17-35(5)18-26-39)40-27-19-36(6)20-28-40)47-34-14-16-44(41-29-21-37(7)22-30-41)42-31-23-38(8)24-32-42/h17-32,43-44H,9-16,33-34H2,1-8H3.
What are the key properties of bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate?
bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate has a molecular weight of 680.76 g/mol, XLogP of 12.03, 20 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4,4-bis(4-methylphenyl)butyl] (tetraethyl-λ5-phosphanyl) borate is sourced from PubChem (CID 67573922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).