C9H19NO2 — CID 67573931
(2S,3R,4S)-3-(dimethylamino)-2,4-dimethyloxan-4-ol (PubChem CID 67573931) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S,3R,4S)-3-(dimethylamino)-2,4-dimethyloxan-4-ol.
| Compound Name | (2S,3R,4S)-3-(dimethylamino)-2,4-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 67573931 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2S,3R,4S)-3-(dimethylamino)-2,4-dimethyloxan-4-ol |
| SMILES | C[C@@H]1OCC[C@](C)(O)[C@@H]1N(C)C |
| InChI | InChI=1S/C9H19NO2/c1-7-8(10(3)4)9(2,11)5-6-12-7/h7-8,11H,5-6H2,1-4H3/t7-,8+,9-/m0/s1 |
| InChIKey | WZZRQTCDSSXYMI-YIZRAAEISA-N |
| XLogP | 0.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |