About bis[1,1-di(piperidin-1-yl)ethyl] carbonate
bis[1,1-di(piperidin-1-yl)ethyl] carbonate (PubChem CID 67574010) has the molecular formula C25H46N4O3
and a molecular weight of 450.67 g/mol. Its IUPAC name is bis[1,1-di(piperidin-1-yl)ethyl] carbonate.
Molecular Properties
| Compound Name | bis[1,1-di(piperidin-1-yl)ethyl] carbonate |
| PubChem CID | 67574010 |
| Molecular Formula | C25H46N4O3 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | bis[1,1-di(piperidin-1-yl)ethyl] carbonate |
| SMILES | CC(OC(=O)OC(C)(N1CCCCC1)N1CCCCC1)(N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C25H46N4O3/c1-24(26-15-7-3-8-16-26,27-17-9-4-10-18-27)31-23(30)32-25(2,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22H2,1-2H3 |
| InChIKey | XMBMCMBKICGWKV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[1,1-di(piperidin-1-yl)ethyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1,1-di(piperidin-1-yl)ethyl] carbonate?
The IUPAC name of bis[1,1-di(piperidin-1-yl)ethyl] carbonate (CID 67574010) is bis[1,1-di(piperidin-1-yl)ethyl] carbonate.
What is the SMILES notation for bis[1,1-di(piperidin-1-yl)ethyl] carbonate?
The canonical SMILES for bis[1,1-di(piperidin-1-yl)ethyl] carbonate is CC(OC(=O)OC(C)(N1CCCCC1)N1CCCCC1)(N1CCCCC1)N1CCCCC1.
What is the InChIKey of bis[1,1-di(piperidin-1-yl)ethyl] carbonate?
The InChIKey is XMBMCMBKICGWKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H46N4O3/c1-24(26-15-7-3-8-16-26,27-17-9-4-10-18-27)31-23(30)32-25(2,28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22H2,1-2H3.
What are the key properties of bis[1,1-di(piperidin-1-yl)ethyl] carbonate?
bis[1,1-di(piperidin-1-yl)ethyl] carbonate has a molecular weight of 450.67 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1,1-di(piperidin-1-yl)ethyl] carbonate is sourced from PubChem (CID 67574010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).