About [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate
[4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate (PubChem CID 67574297) has the molecular formula C13H14ClFN4O2S
and a molecular weight of 344.80 g/mol. Its IUPAC name is [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate.
Molecular Properties
| Compound Name | [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate |
| PubChem CID | 67574297 |
| Molecular Formula | C13H14ClFN4O2S |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate |
| SMILES | CCC(C)NC(=O)Oc1nsnc1-c1c(F)ccc(N)c1Cl |
| InChI | InChI=1S/C13H14ClFN4O2S/c1-3-6(2)17-13(20)21-12-11(18-22-19-12)9-7(15)4-5-8(16)10(9)14/h4-6H,3,16H2,1-2H3,(H,17,20) |
| InChIKey | XDFHWKMVNGDKBY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate?
The IUPAC name of [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate (CID 67574297) is [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate.
What is the SMILES notation for [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate?
The canonical SMILES for [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate is CCC(C)NC(=O)Oc1nsnc1-c1c(F)ccc(N)c1Cl.
What is the InChIKey of [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate?
The InChIKey is XDFHWKMVNGDKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClFN4O2S/c1-3-6(2)17-13(20)21-12-11(18-22-19-12)9-7(15)4-5-8(16)10(9)14/h4-6H,3,16H2,1-2H3,(H,17,20).
What are the key properties of [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate?
[4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate has a molecular weight of 344.80 g/mol, XLogP of 3.47, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-amino-2-chloro-6-fluorophenyl)-1,2,5-thiadiazol-3-yl] N-butan-2-ylcarbamate is sourced from PubChem (CID 67574297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).