C12H22O7 — CID 67574956
(3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;dimethyl carbonate;prop-1-ene (PubChem CID 67574956) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;dimethyl carbonate;prop-1-ene.
| Compound Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;dimethyl carbonate;prop-1-ene |
|---|---|
| PubChem CID | 67574956 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;dimethyl carbonate;prop-1-ene |
| SMILES | C=CC.COC(=O)OC.O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C6H10O4.C3H6O3.C3H6/c7-3-1-9-6-4(8)2-10-5(3)6;1-5-3(4)6-2;1-3-2/h3-8H,1-2H2;1-2H3;3H,1H2,2H3/t3-,4+,5-,6-;;/m1../s1 |
| InChIKey | AILKPKZWLUVUJF-MGXNYLRYSA-N |
| XLogP | 0.10 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|